C11H13ClN2O2 — CID 65250202
1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]azetidin-3-amine (PubChem CID 65250202) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]azetidin-3-amine.
| Compound Name | 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]azetidin-3-amine |
|---|---|
| PubChem CID | 65250202 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]azetidin-3-amine |
| SMILES | NC1CN(Cc2cc(Cl)c3c(c2)OCO3)C1 |
| InChI | InChI=1S/C11H13ClN2O2/c12-9-1-7(3-14-4-8(13)5-14)2-10-11(9)16-6-15-10/h1-2,8H,3-6,13H2 |
| InChIKey | IUSQRBRQMVWYBX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |