C11H12ClNO2 — CID 43087529
N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]cyclopropanamine (PubChem CID 43087529) has the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. Its IUPAC name is N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]cyclopropanamine.
| Compound Name | N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43087529 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]cyclopropanamine |
| SMILES | Clc1cc(CNC2CC2)cc2c1OCO2 |
| InChI | InChI=1S/C11H12ClNO2/c12-9-3-7(5-13-8-1-2-8)4-10-11(9)15-6-14-10/h3-4,8,13H,1-2,5-6H2 |
| InChIKey | DPVTUGQGCNMSAW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |