C15H20ClNO3 — CID 63825313
N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2-cyclopentyloxyethanamine (PubChem CID 63825313) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2-cyclopentyloxyethanamine.
| Compound Name | N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2-cyclopentyloxyethanamine |
|---|---|
| PubChem CID | 63825313 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2-cyclopentyloxyethanamine |
| SMILES | Clc1cc(CNCCOC2CCCC2)cc2c1OCO2 |
| InChI | InChI=1S/C15H20ClNO3/c16-13-7-11(8-14-15(13)20-10-19-14)9-17-5-6-18-12-3-1-2-4-12/h7-8,12,17H,1-6,9-10H2 |
| InChIKey | PNFJPYKLQDAKNC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|