C15H21F2NO — CID 115767735
2-cyclohexyloxy-N-[(3,5-difluorophenyl)methyl]ethanamine (PubChem CID 115767735) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-cyclohexyloxy-N-[(3,5-difluorophenyl)methyl]ethanamine.
| Compound Name | 2-cyclohexyloxy-N-[(3,5-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 115767735 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-cyclohexyloxy-N-[(3,5-difluorophenyl)methyl]ethanamine |
| SMILES | Fc1cc(F)cc(CNCCOC2CCCCC2)c1 |
| InChI | InChI=1S/C15H21F2NO/c16-13-8-12(9-14(17)10-13)11-18-6-7-19-15-4-2-1-3-5-15/h8-10,15,18H,1-7,11H2 |
| InChIKey | PSWSAZNGUCEXDX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|