C15H19FN2O — CID 55261259
3-[(2-cyclopentyloxyethylamino)methyl]-4-fluorobenzonitrile (PubChem CID 55261259) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-[(2-cyclopentyloxyethylamino)methyl]-4-fluorobenzonitrile.
| Compound Name | 3-[(2-cyclopentyloxyethylamino)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 55261259 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3-[(2-cyclopentyloxyethylamino)methyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(CNCCOC2CCCC2)c1 |
| InChI | InChI=1S/C15H19FN2O/c16-15-6-5-12(10-17)9-13(15)11-18-7-8-19-14-3-1-2-4-14/h5-6,9,14,18H,1-4,7-8,11H2 |
| InChIKey | UDZJZQCMCFHJSP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|