C17H26FNO — CID 63645848
3-cyclohexyloxy-N-[(3-fluoro-4-methylphenyl)methyl]propan-1-amine (PubChem CID 63645848) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is 3-cyclohexyloxy-N-[(3-fluoro-4-methylphenyl)methyl]propan-1-amine.
| Compound Name | 3-cyclohexyloxy-N-[(3-fluoro-4-methylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 63645848 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 3-cyclohexyloxy-N-[(3-fluoro-4-methylphenyl)methyl]propan-1-amine |
| SMILES | Cc1ccc(CNCCCOC2CCCCC2)cc1F |
| InChI | InChI=1S/C17H26FNO/c1-14-8-9-15(12-17(14)18)13-19-10-5-11-20-16-6-3-2-4-7-16/h8-9,12,16,19H,2-7,10-11,13H2,1H3 |
| InChIKey | AJTBAIOYNDHSKP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|