C14H22FNO — CID 103654079
N-[(3-fluoro-4-methylphenyl)methyl]-5-methoxypentan-1-amine (PubChem CID 103654079) has the molecular formula C14H22FNO and a molecular weight of 239.33 g/mol. Its IUPAC name is N-[(3-fluoro-4-methylphenyl)methyl]-5-methoxypentan-1-amine.
| Compound Name | N-[(3-fluoro-4-methylphenyl)methyl]-5-methoxypentan-1-amine |
|---|---|
| PubChem CID | 103654079 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-[(3-fluoro-4-methylphenyl)methyl]-5-methoxypentan-1-amine |
| SMILES | COCCCCCNCc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C14H22FNO/c1-12-6-7-13(10-14(12)15)11-16-8-4-3-5-9-17-2/h6-7,10,16H,3-5,8-9,11H2,1-2H3 |
| InChIKey | YXVGNIWYRMAHKD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|