C11H12ClNO4 — CID 43143716
3-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]propanoic acid (PubChem CID 43143716) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is 3-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]propanoic acid.
| Compound Name | 3-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 43143716 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 3-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C11H12ClNO4/c12-8-3-7(5-13-2-1-10(14)15)4-9-11(8)17-6-16-9/h3-4,13H,1-2,5-6H2,(H,14,15) |
| InChIKey | AAEBBKIKJRRKDS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|