C15H21ClN2O3 — CID 61021965
N-butan-2-yl-3-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]propanamide (PubChem CID 61021965) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-butan-2-yl-3-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]propanamide.
| Compound Name | N-butan-2-yl-3-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 61021965 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-butan-2-yl-3-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]propanamide |
| SMILES | CCC(C)NC(=O)CCNCc1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C15H21ClN2O3/c1-3-10(2)18-14(19)4-5-17-8-11-6-12(16)15-13(7-11)20-9-21-15/h6-7,10,17H,3-5,8-9H2,1-2H3,(H,18,19) |
| InChIKey | XNNMALSAPIKDHB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|