C16H24N2O2 — CID 61022339
N-butan-2-yl-3-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propanamide (PubChem CID 61022339) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-butan-2-yl-3-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propanamide.
| Compound Name | N-butan-2-yl-3-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 61022339 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-butan-2-yl-3-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propanamide |
| SMILES | CCC(C)NC(=O)CCNCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H24N2O2/c1-3-12(2)18-16(19)6-8-17-11-13-4-5-15-14(10-13)7-9-20-15/h4-5,10,12,17H,3,6-9,11H2,1-2H3,(H,18,19) |
| InChIKey | ZAKCBQDWCCDLGR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|