methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate

C14H19NO3 — CID 115232397

IUPACmethyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate
SMILESCOC(=O)CCNCc1ccc2c(c1)CCCO2
InChIInChI=1S/C14H19NO3/c1-17-14(16)6-7-15-10-11-4-5-13-12(9-11)3-2-8-18-13/h4-5,9,15H,2-3,6-8,10H2,1H3
InChIKeyOSGQGHFZBYZODC-UHFFFAOYSA-N
MW249.31 g/mol
LogP1.66
Rot. Bonds5

About methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate

methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate (PubChem CID 115232397) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate.

Molecular Properties

Compound Namemethyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate
PubChem CID115232397
Molecular FormulaC14H19NO3
Molecular Weight249.31 g/mol
Exact Mass249.14
IUPAC Namemethyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate
SMILESCOC(=O)CCNCc1ccc2c(c1)CCCO2
InChIInChI=1S/C14H19NO3/c1-17-14(16)6-7-15-10-11-4-5-13-12(9-11)3-2-8-18-13/h4-5,9,15H,2-3,6-8,10H2,1H3
InChIKeyOSGQGHFZBYZODC-UHFFFAOYSA-N
XLogP1.66
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 51.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate?
The IUPAC name of methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate (CID 115232397) is methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate.
What is the SMILES notation for methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate?
The canonical SMILES for methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate is COC(=O)CCNCc1ccc2c(c1)CCCO2.
What is the InChIKey of methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate?
The InChIKey is OSGQGHFZBYZODC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-17-14(16)6-7-15-10-11-4-5-13-12(9-11)3-2-8-18-13/h4-5,9,15H,2-3,6-8,10H2,1H3.
What are the key properties of methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate?
methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate has a molecular weight of 249.31 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,4-dihydro-2H-chromen-6-ylmethylamino)propanoate is sourced from PubChem (CID 115232397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).