C11H14O2 — CID 116932250
6-(methoxymethyl)-3,4-dihydro-2H-chromene (PubChem CID 116932250) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-(methoxymethyl)-3,4-dihydro-2H-chromene.
| Compound Name | 6-(methoxymethyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 116932250 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 6-(methoxymethyl)-3,4-dihydro-2H-chromene |
| SMILES | COCc1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C11H14O2/c1-12-8-9-4-5-11-10(7-9)3-2-6-13-11/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | MXQGGHDYOFYVNE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |