C14H20N2O3 — CID 115241690
3-amino-4-(3,4-dihydro-2H-chromen-6-ylmethylamino)butanoic acid (PubChem CID 115241690) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-amino-4-(3,4-dihydro-2H-chromen-6-ylmethylamino)butanoic acid.
| Compound Name | 3-amino-4-(3,4-dihydro-2H-chromen-6-ylmethylamino)butanoic acid |
|---|---|
| PubChem CID | 115241690 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-amino-4-(3,4-dihydro-2H-chromen-6-ylmethylamino)butanoic acid |
| SMILES | NC(CNCc1ccc2c(c1)CCCO2)CC(=O)O |
| InChI | InChI=1S/C14H20N2O3/c15-12(7-14(17)18)9-16-8-10-3-4-13-11(6-10)2-1-5-19-13/h3-4,6,12,16H,1-2,5,7-9,15H2,(H,17,18) |
| InChIKey | KVGRGYPXBKPVMP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|