C13H18N2O3 — CID 116942828
3,4-diamino-4-(3,4-dihydro-2H-chromen-6-yl)butanoic acid (PubChem CID 116942828) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3,4-diamino-4-(3,4-dihydro-2H-chromen-6-yl)butanoic acid.
| Compound Name | 3,4-diamino-4-(3,4-dihydro-2H-chromen-6-yl)butanoic acid |
|---|---|
| PubChem CID | 116942828 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3,4-diamino-4-(3,4-dihydro-2H-chromen-6-yl)butanoic acid |
| SMILES | NC(CC(=O)O)C(N)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C13H18N2O3/c14-10(7-12(16)17)13(15)9-3-4-11-8(6-9)2-1-5-18-11/h3-4,6,10,13H,1-2,5,7,14-15H2,(H,16,17) |
| InChIKey | AOTDXVZKZVETPT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |