C11H15NO2 — CID 82241106
2-amino-1-(3,4-dihydro-2H-chromen-6-yl)ethanol (PubChem CID 82241106) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-amino-1-(3,4-dihydro-2H-chromen-6-yl)ethanol.
| Compound Name | 2-amino-1-(3,4-dihydro-2H-chromen-6-yl)ethanol |
|---|---|
| PubChem CID | 82241106 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-amino-1-(3,4-dihydro-2H-chromen-6-yl)ethanol |
| SMILES | NCC(O)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C11H15NO2/c12-7-10(13)8-3-4-11-9(6-8)2-1-5-14-11/h3-4,6,10,13H,1-2,5,7,12H2 |
| InChIKey | MBIHLTNWHOEKRC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |