C12H18N2O2 — CID 116942558
1,3-diamino-1-(3,4-dihydro-2H-chromen-6-yl)propan-2-ol (PubChem CID 116942558) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 1,3-diamino-1-(3,4-dihydro-2H-chromen-6-yl)propan-2-ol.
| Compound Name | 1,3-diamino-1-(3,4-dihydro-2H-chromen-6-yl)propan-2-ol |
|---|---|
| PubChem CID | 116942558 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1,3-diamino-1-(3,4-dihydro-2H-chromen-6-yl)propan-2-ol |
| SMILES | NCC(O)C(N)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C12H18N2O2/c13-7-10(15)12(14)9-3-4-11-8(6-9)2-1-5-16-11/h3-4,6,10,12,15H,1-2,5,7,13-14H2 |
| InChIKey | GLZGBSKKFIIHIM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |