C17H20N2O — CID 116936978
[3-(aminomethyl)phenyl]-(3,4-dihydro-2H-chromen-6-yl)methanamine (PubChem CID 116936978) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is [3-(aminomethyl)phenyl]-(3,4-dihydro-2H-chromen-6-yl)methanamine.
| Compound Name | [3-(aminomethyl)phenyl]-(3,4-dihydro-2H-chromen-6-yl)methanamine |
|---|---|
| PubChem CID | 116936978 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | [3-(aminomethyl)phenyl]-(3,4-dihydro-2H-chromen-6-yl)methanamine |
| SMILES | NCc1cccc(C(N)c2ccc3c(c2)CCCO3)c1 |
| InChI | InChI=1S/C17H20N2O/c18-11-12-3-1-4-14(9-12)17(19)15-6-7-16-13(10-15)5-2-8-20-16/h1,3-4,6-7,9-10,17H,2,5,8,11,18-19H2 |
| InChIKey | SMJHUBNPYFDZQR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |