C14H14INOS — CID 79693199
3,4-dihydro-2H-chromen-6-yl-(5-iodothiophen-3-yl)methanamine (PubChem CID 79693199) has the molecular formula C14H14INOS and a molecular weight of 371.24 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-6-yl-(5-iodothiophen-3-yl)methanamine.
| Compound Name | 3,4-dihydro-2H-chromen-6-yl-(5-iodothiophen-3-yl)methanamine |
|---|---|
| PubChem CID | 79693199 |
| Molecular Formula | C14H14INOS |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 3,4-dihydro-2H-chromen-6-yl-(5-iodothiophen-3-yl)methanamine |
| SMILES | NC(c1csc(I)c1)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C14H14INOS/c15-13-7-11(8-18-13)14(16)10-3-4-12-9(6-10)2-1-5-17-12/h3-4,6-8,14H,1-2,5,16H2 |
| InChIKey | ZUTLJWZTBGMYOK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|