C14H13IN2OS — CID 79685089
6-[amino-(5-iodothiophen-3-yl)methyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 79685089) has the molecular formula C14H13IN2OS and a molecular weight of 384.24 g/mol. Its IUPAC name is 6-[amino-(5-iodothiophen-3-yl)methyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[amino-(5-iodothiophen-3-yl)methyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 79685089 |
| Molecular Formula | C14H13IN2OS |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 6-[amino-(5-iodothiophen-3-yl)methyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | NC(c1csc(I)c1)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H13IN2OS/c15-12-6-10(7-19-12)14(16)9-1-3-11-8(5-9)2-4-13(18)17-11/h1,3,5-7,14H,2,4,16H2,(H,17,18) |
| InChIKey | MWILWYIFVPXTPB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|