C16H14BrClN2O — CID 107950188
6-[amino-(3-bromo-5-chlorophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 107950188) has the molecular formula C16H14BrClN2O and a molecular weight of 365.66 g/mol. Its IUPAC name is 6-[amino-(3-bromo-5-chlorophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[amino-(3-bromo-5-chlorophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 107950188 |
| Molecular Formula | C16H14BrClN2O |
| Molecular Weight | 365.66 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 6-[amino-(3-bromo-5-chlorophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | NC(c1cc(Cl)cc(Br)c1)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C16H14BrClN2O/c17-12-6-11(7-13(18)8-12)16(19)10-1-3-14-9(5-10)2-4-15(21)20-14/h1,3,5-8,16H,2,4,19H2,(H,20,21) |
| InChIKey | XQJCAJGPSCSLJD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |