C15H12Cl2N2O — CID 43096298
5-[amino-(3,5-dichlorophenyl)methyl]-1,3-dihydroindol-2-one (PubChem CID 43096298) has the molecular formula C15H12Cl2N2O and a molecular weight of 307.18 g/mol. Its IUPAC name is 5-[amino-(3,5-dichlorophenyl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[amino-(3,5-dichlorophenyl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43096298 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 5-[amino-(3,5-dichlorophenyl)methyl]-1,3-dihydroindol-2-one |
| SMILES | NC(c1cc(Cl)cc(Cl)c1)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C15H12Cl2N2O/c16-11-4-10(5-12(17)7-11)15(18)8-1-2-13-9(3-8)6-14(20)19-13/h1-5,7,15H,6,18H2,(H,19,20) |
| InChIKey | ILERCVYYRBSXQM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |