C16H17N3O — CID 116936683
5-[amino-[3-(methylamino)phenyl]methyl]-1,3-dihydroindol-2-one (PubChem CID 116936683) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 5-[amino-[3-(methylamino)phenyl]methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[amino-[3-(methylamino)phenyl]methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 116936683 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 5-[amino-[3-(methylamino)phenyl]methyl]-1,3-dihydroindol-2-one |
| SMILES | CNc1cccc(C(N)c2ccc3c(c2)CC(=O)N3)c1 |
| InChI | InChI=1S/C16H17N3O/c1-18-13-4-2-3-10(8-13)16(17)11-5-6-14-12(7-11)9-15(20)19-14/h2-8,16,18H,9,17H2,1H3,(H,19,20) |
| InChIKey | NATCFSKIZHUHGN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |