C19H16N2O — CID 43824898
5-[amino(naphthalen-2-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 43824898) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-[amino(naphthalen-2-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[amino(naphthalen-2-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43824898 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-[amino(naphthalen-2-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | NC(c1ccc2c(c1)CC(=O)N2)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H16N2O/c20-19(14-6-5-12-3-1-2-4-13(12)9-14)15-7-8-17-16(10-15)11-18(22)21-17/h1-10,19H,11,20H2,(H,21,22) |
| InChIKey | YDEUVWYQLZLONE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |