C14H13N3O — CID 43198851
5-[amino(pyridin-3-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 43198851) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 5-[amino(pyridin-3-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[amino(pyridin-3-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43198851 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 5-[amino(pyridin-3-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | NC(c1cccnc1)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C14H13N3O/c15-14(10-2-1-5-16-8-10)9-3-4-12-11(6-9)7-13(18)17-12/h1-6,8,14H,7,15H2,(H,17,18) |
| InChIKey | YXSVQGPERCPMHA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |