C16H12Br3NO — CID 107980890
6-[bromo-(3,5-dibromophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 107980890) has the molecular formula C16H12Br3NO and a molecular weight of 473.99 g/mol. Its IUPAC name is 6-[bromo-(3,5-dibromophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[bromo-(3,5-dibromophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 107980890 |
| Molecular Formula | C16H12Br3NO |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 470.85 |
| IUPAC Name | 6-[bromo-(3,5-dibromophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(Br)c3cc(Br)cc(Br)c3)ccc2N1 |
| InChI | InChI=1S/C16H12Br3NO/c17-12-6-11(7-13(18)8-12)16(19)10-1-3-14-9(5-10)2-4-15(21)20-14/h1,3,5-8,16H,2,4H2,(H,20,21) |
| InChIKey | ZNEFWFHGBYZYTN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|