C14H11Br2NO2 — CID 61096119
6-[bromo-(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 61096119) has the molecular formula C14H11Br2NO2 and a molecular weight of 385.06 g/mol. Its IUPAC name is 6-[bromo-(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[bromo-(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 61096119 |
| Molecular Formula | C14H11Br2NO2 |
| Molecular Weight | 385.06 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | 6-[bromo-(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(Br)c3ccc(Br)o3)ccc2N1 |
| InChI | InChI=1S/C14H11Br2NO2/c15-12-5-4-11(19-12)14(16)9-1-3-10-8(7-9)2-6-13(18)17-10/h1,3-5,7,14H,2,6H2,(H,17,18) |
| InChIKey | SLSHPDNPIOUAAO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.06 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|