C15H13Br2NOS — CID 79996839
6-[bromo-(5-bromo-4-methylthiophen-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 79996839) has the molecular formula C15H13Br2NOS and a molecular weight of 415.15 g/mol. Its IUPAC name is 6-[bromo-(5-bromo-4-methylthiophen-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[bromo-(5-bromo-4-methylthiophen-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 79996839 |
| Molecular Formula | C15H13Br2NOS |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 412.91 |
| IUPAC Name | 6-[bromo-(5-bromo-4-methylthiophen-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cc(C(Br)c2ccc3c(c2)CCC(=O)N3)sc1Br |
| InChI | InChI=1S/C15H13Br2NOS/c1-8-6-12(20-15(8)17)14(16)10-2-4-11-9(7-10)3-5-13(19)18-11/h2,4,6-7,14H,3,5H2,1H3,(H,18,19) |
| InChIKey | BNUXPPUYDMQHRE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|