C15H14BrNOS — CID 61096318
6-[bromo-(5-methylthiophen-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 61096318) has the molecular formula C15H14BrNOS and a molecular weight of 336.25 g/mol. Its IUPAC name is 6-[bromo-(5-methylthiophen-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[bromo-(5-methylthiophen-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 61096318 |
| Molecular Formula | C15H14BrNOS |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 6-[bromo-(5-methylthiophen-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1ccc(C(Br)c2ccc3c(c2)CCC(=O)N3)s1 |
| InChI | InChI=1S/C15H14BrNOS/c1-9-2-6-13(19-9)15(16)11-3-5-12-10(8-11)4-7-14(18)17-12/h2-3,5-6,8,15H,4,7H2,1H3,(H,17,18) |
| InChIKey | PKTODHABVKHDIB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|