C12H12BrNO2 — CID 116859777
6-(1-bromo-2-oxopropyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 116859777) has the molecular formula C12H12BrNO2 and a molecular weight of 282.14 g/mol. Its IUPAC name is 6-(1-bromo-2-oxopropyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(1-bromo-2-oxopropyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 116859777 |
| Molecular Formula | C12H12BrNO2 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 6-(1-bromo-2-oxopropyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC(=O)C(Br)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C12H12BrNO2/c1-7(15)12(13)9-2-4-10-8(6-9)3-5-11(16)14-10/h2,4,6,12H,3,5H2,1H3,(H,14,16) |
| InChIKey | NADIAGUTVVJWPM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|