C12H15NO2 — CID 19854697
6-(1-hydroxypropyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 19854697) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-(1-hydroxypropyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(1-hydroxypropyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 19854697 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 6-(1-hydroxypropyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCC(O)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C12H15NO2/c1-2-11(14)9-3-5-10-8(7-9)4-6-12(15)13-10/h3,5,7,11,14H,2,4,6H2,1H3,(H,13,15) |
| InChIKey | TXEKLBUUTWMRBY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |