C13H17NO2 — CID 116964107
6-(1-hydroxybutan-2-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 116964107) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 6-(1-hydroxybutan-2-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(1-hydroxybutan-2-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 116964107 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 6-(1-hydroxybutan-2-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCC(CO)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C13H17NO2/c1-2-9(8-15)10-3-5-12-11(7-10)4-6-13(16)14-12/h3,5,7,9,15H,2,4,6,8H2,1H3,(H,14,16) |
| InChIKey | YIUSODJBNGXIMX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |