C14H13BrN2O2 — CID 43464148
6-[amino-(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43464148) has the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. Its IUPAC name is 6-[amino-(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[amino-(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43464148 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 6-[amino-(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | NC(c1ccc2c(c1)CCC(=O)N2)c1ccc(Br)o1 |
| InChI | InChI=1S/C14H13BrN2O2/c15-12-5-4-11(19-12)14(16)9-1-3-10-8(7-9)2-6-13(18)17-10/h1,3-5,7,14H,2,6,16H2,(H,17,18) |
| InChIKey | IDAXDIHGZUVIJD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |