C16H12Br2ClNO — CID 114374918
6-[chloro-(2,5-dibromophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 114374918) has the molecular formula C16H12Br2ClNO and a molecular weight of 429.54 g/mol. Its IUPAC name is 6-[chloro-(2,5-dibromophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[chloro-(2,5-dibromophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 114374918 |
| Molecular Formula | C16H12Br2ClNO |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 426.90 |
| IUPAC Name | 6-[chloro-(2,5-dibromophenyl)methyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(Cl)c3cc(Br)ccc3Br)ccc2N1 |
| InChI | InChI=1S/C16H12Br2ClNO/c17-11-3-4-13(18)12(8-11)16(19)10-1-5-14-9(7-10)2-6-15(21)20-14/h1,3-5,7-8,16H,2,6H2,(H,20,21) |
| InChIKey | GERDXWMMCMPSNT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|