C16H12BrCl2NO — CID 107991468
6-[(2-bromo-4-chlorophenyl)-chloromethyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 107991468) has the molecular formula C16H12BrCl2NO and a molecular weight of 385.09 g/mol. Its IUPAC name is 6-[(2-bromo-4-chlorophenyl)-chloromethyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(2-bromo-4-chlorophenyl)-chloromethyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 107991468 |
| Molecular Formula | C16H12BrCl2NO |
| Molecular Weight | 385.09 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | 6-[(2-bromo-4-chlorophenyl)-chloromethyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(Cl)c3ccc(Cl)cc3Br)ccc2N1 |
| InChI | InChI=1S/C16H12BrCl2NO/c17-13-8-11(18)3-4-12(13)16(19)10-1-5-14-9(7-10)2-6-15(21)20-14/h1,3-5,7-8,16H,2,6H2,(H,20,21) |
| InChIKey | FVAJAFPHLSTYJH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.09 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|