C9H8ClNO — CID 11240825
6-chloro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 11240825) has the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. Its IUPAC name is 6-chloro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-chloro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 11240825 |
| Molecular Formula | C9H8ClNO |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 6-chloro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C9H8ClNO/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h2-3,5H,1,4H2,(H,11,12) |
| InChIKey | QKDOVTGWTBEYMG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |