C9H10BNO3 — CID 59763201
(2-oxo-3,4-dihydro-1H-quinolin-6-yl)boronic acid (PubChem CID 59763201) has the molecular formula C9H10BNO3 and a molecular weight of 191.00 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl)boronic acid.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl)boronic acid |
|---|---|
| PubChem CID | 59763201 |
| Molecular Formula | C9H10BNO3 |
| Molecular Weight | 191.00 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl)boronic acid |
| SMILES | O=C1CCc2cc(B(O)O)ccc2N1 |
| InChI | InChI=1S/C9H10BNO3/c12-9-4-1-6-5-7(10(13)14)2-3-8(6)11-9/h2-3,5,13-14H,1,4H2,(H,11,12) |
| InChIKey | WIVDQJWQFUTPOH-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.00 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|