C11H12N2O — CID 82468625
6-(aziridin-2-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82468625) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-(aziridin-2-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(aziridin-2-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82468625 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 6-(aziridin-2-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C3CN3)ccc2N1 |
| InChI | InChI=1S/C11H12N2O/c14-11-4-2-7-5-8(10-6-12-10)1-3-9(7)13-11/h1,3,5,10,12H,2,4,6H2,(H,13,14) |
| InChIKey | NWPKKUQOVFRZBB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|