C10H12N2 — CID 88562655
5-(aziridin-2-yl)-2,3-dihydro-1H-indole (PubChem CID 88562655) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 5-(aziridin-2-yl)-2,3-dihydro-1H-indole.
| Compound Name | 5-(aziridin-2-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 88562655 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5-(aziridin-2-yl)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(cc1C1CN1)CCN2 |
| InChI | InChI=1S/C10H12N2/c1-2-9-8(3-4-11-9)5-7(1)10-6-12-10/h1-2,5,10-12H,3-4,6H2 |
| InChIKey | MFFKIQQOSTUUAG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 33.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|