C10H16Cl2N2 — CID 139022525
N,N-dimethyl-2,3-dihydro-1H-indol-5-amine;dihydrochloride (PubChem CID 139022525) has the molecular formula C10H16Cl2N2 and a molecular weight of 235.16 g/mol. Its IUPAC name is N,N-dimethyl-2,3-dihydro-1H-indol-5-amine;dihydrochloride.
| Compound Name | N,N-dimethyl-2,3-dihydro-1H-indol-5-amine;dihydrochloride |
|---|---|
| PubChem CID | 139022525 |
| Molecular Formula | C10H16Cl2N2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | N,N-dimethyl-2,3-dihydro-1H-indol-5-amine;dihydrochloride |
| SMILES | CN(C)c1ccc2c(c1)CCN2.Cl.Cl |
| InChI | InChI=1S/C10H14N2.2ClH/c1-12(2)9-3-4-10-8(7-9)5-6-11-10;;/h3-4,7,11H,5-6H2,1-2H3;2*1H |
| InChIKey | KEPVCOLUDOIINC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|