C9H14Cl2N2 — CID 175177569
N-methyl-2,3-dihydro-1H-indol-5-amine;dihydrochloride (PubChem CID 175177569) has the molecular formula C9H14Cl2N2 and a molecular weight of 221.13 g/mol. Its IUPAC name is N-methyl-2,3-dihydro-1H-indol-5-amine;dihydrochloride.
| Compound Name | N-methyl-2,3-dihydro-1H-indol-5-amine;dihydrochloride |
|---|---|
| PubChem CID | 175177569 |
| Molecular Formula | C9H14Cl2N2 |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | N-methyl-2,3-dihydro-1H-indol-5-amine;dihydrochloride |
| SMILES | CNc1ccc2c(c1)CCN2.Cl.Cl |
| InChI | InChI=1S/C9H12N2.2ClH/c1-10-8-2-3-9-7(6-8)4-5-11-9;;/h2-3,6,10-11H,4-5H2,1H3;2*1H |
| InChIKey | YJBUIYQYIVBNEL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |