C11H16N2O4S2 — CID 63242833
N-(2,3-dihydro-1H-indol-5-yl)-2-methylsulfonylethanesulfonamide (PubChem CID 63242833) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-yl)-2-methylsulfonylethanesulfonamide.
| Compound Name | N-(2,3-dihydro-1H-indol-5-yl)-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 63242833 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-yl)-2-methylsulfonylethanesulfonamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)Nc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C11H16N2O4S2/c1-18(14,15)6-7-19(16,17)13-10-2-3-11-9(8-10)4-5-12-11/h2-3,8,12-13H,4-7H2,1H3 |
| InChIKey | JHUCSCPPKDRKSG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |