C12H16N2O4S — CID 55173042
methyl 2-(1,2,3,4-tetrahydroquinolin-6-ylsulfamoyl)acetate (PubChem CID 55173042) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is methyl 2-(1,2,3,4-tetrahydroquinolin-6-ylsulfamoyl)acetate.
| Compound Name | methyl 2-(1,2,3,4-tetrahydroquinolin-6-ylsulfamoyl)acetate |
|---|---|
| PubChem CID | 55173042 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methyl 2-(1,2,3,4-tetrahydroquinolin-6-ylsulfamoyl)acetate |
| SMILES | COC(=O)CS(=O)(=O)Nc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C12H16N2O4S/c1-18-12(15)8-19(16,17)14-10-4-5-11-9(7-10)3-2-6-13-11/h4-5,7,13-14H,2-3,6,8H2,1H3 |
| InChIKey | DZSBMWPXXWFLOD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |