C13H15N3O2S — CID 63283396
2-oxo-N-(1,2,3,4-tetrahydroquinolin-6-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 63283396) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-oxo-N-(1,2,3,4-tetrahydroquinolin-6-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-oxo-N-(1,2,3,4-tetrahydroquinolin-6-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 63283396 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-oxo-N-(1,2,3,4-tetrahydroquinolin-6-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)Nc2ccc3c(c2)CCCN3)CS1 |
| InChI | InChI=1S/C13H15N3O2S/c17-12(11-7-19-13(18)16-11)15-9-3-4-10-8(6-9)2-1-5-14-10/h3-4,6,11,14H,1-2,5,7H2,(H,15,17)(H,16,18) |
| InChIKey | GTYVFZFJDXXFHZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|