C16H20N2O — CID 81479241
N-(2,3-dihydro-1H-indol-5-yl)bicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 81479241) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-yl)bicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-indol-5-yl)bicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 81479241 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-yl)bicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCN2)C1C2CCCCC21 |
| InChI | InChI=1S/C16H20N2O/c19-16(15-12-3-1-2-4-13(12)15)18-11-5-6-14-10(9-11)7-8-17-14/h5-6,9,12-13,15,17H,1-4,7-8H2,(H,18,19) |
| InChIKey | HUBYCXURUQFAIL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |