C13H16N2O — CID 63252649
N-(2,3-dihydro-1H-indol-5-yl)cyclobutanecarboxamide (PubChem CID 63252649) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-yl)cyclobutanecarboxamide.
| Compound Name | N-(2,3-dihydro-1H-indol-5-yl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 63252649 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-yl)cyclobutanecarboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCN2)C1CCC1 |
| InChI | InChI=1S/C13H16N2O/c16-13(9-2-1-3-9)15-11-4-5-12-10(8-11)6-7-14-12/h4-5,8-9,14H,1-3,6-7H2,(H,15,16) |
| InChIKey | RJIPDCRLNLXMQS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |