C17H24N2O — CID 62633858
N-(1,2,3,4-tetrahydroquinolin-6-yl)cycloheptanecarboxamide (PubChem CID 62633858) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroquinolin-6-yl)cycloheptanecarboxamide.
| Compound Name | N-(1,2,3,4-tetrahydroquinolin-6-yl)cycloheptanecarboxamide |
|---|---|
| PubChem CID | 62633858 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-(1,2,3,4-tetrahydroquinolin-6-yl)cycloheptanecarboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCCN2)C1CCCCCC1 |
| InChI | InChI=1S/C17H24N2O/c20-17(13-6-3-1-2-4-7-13)19-15-9-10-16-14(12-15)8-5-11-18-16/h9-10,12-13,18H,1-8,11H2,(H,19,20) |
| InChIKey | WYBGUIPIKUTZBT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |