C10H8BrFN2O2S — CID 65429945
N-(4-bromo-3-fluorophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 65429945) has the molecular formula C10H8BrFN2O2S and a molecular weight of 319.16 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 65429945 |
| Molecular Formula | C10H8BrFN2O2S |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)Nc2ccc(Br)c(F)c2)CS1 |
| InChI | InChI=1S/C10H8BrFN2O2S/c11-6-2-1-5(3-7(6)12)13-9(15)8-4-17-10(16)14-8/h1-3,8H,4H2,(H,13,15)(H,14,16) |
| InChIKey | FBMYAFIZTPKJDX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|