C10H8Cl2N2O3S — CID 82885183
N-(3,5-dichloro-4-hydroxyphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 82885183) has the molecular formula C10H8Cl2N2O3S and a molecular weight of 307.16 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 82885183 |
| Molecular Formula | C10H8Cl2N2O3S |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)Nc2cc(Cl)c(O)c(Cl)c2)CS1 |
| InChI | InChI=1S/C10H8Cl2N2O3S/c11-5-1-4(2-6(12)8(5)15)13-9(16)7-3-18-10(17)14-7/h1-2,7,15H,3H2,(H,13,16)(H,14,17) |
| InChIKey | ICVCJYHDTUFWCD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|