C12H12N2O4S — CID 65346582
2-[3-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]phenyl]acetic acid (PubChem CID 65346582) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-[3-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]phenyl]acetic acid.
| Compound Name | 2-[3-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 65346582 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-[3-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(NC(=O)C2CSC(=O)N2)c1 |
| InChI | InChI=1S/C12H12N2O4S/c15-10(16)5-7-2-1-3-8(4-7)13-11(17)9-6-19-12(18)14-9/h1-4,9H,5-6H2,(H,13,17)(H,14,18)(H,15,16) |
| InChIKey | OSYBPYHKCBMEKI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|