C11H9ClN2O4S — CID 61398506
2-chloro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid (PubChem CID 61398506) has the molecular formula C11H9ClN2O4S and a molecular weight of 300.72 g/mol. Its IUPAC name is 2-chloro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid.
| Compound Name | 2-chloro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61398506 |
| Molecular Formula | C11H9ClN2O4S |
| Molecular Weight | 300.72 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 2-chloro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid |
| SMILES | O=C1NC(C(=O)Nc2ccc(C(=O)O)c(Cl)c2)CS1 |
| InChI | InChI=1S/C11H9ClN2O4S/c12-7-3-5(1-2-6(7)10(16)17)13-9(15)8-4-19-11(18)14-8/h1-3,8H,4H2,(H,13,15)(H,14,18)(H,16,17) |
| InChIKey | GNYYGSYEJFFXKO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.72 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|